C21H28N+ — CID 177074933
5-tert-butyl-1-methyl-2-(5,5,8,8-tetradeuterio-3-methyl-6,7-dihydronaphthalen-2-yl)pyridin-1-ium (PubChem CID 177074933) has the molecular formula C21H28N+ and a molecular weight of 298.49 g/mol. Its IUPAC name is 5-tert-butyl-1-methyl-2-(5,5,8,8-tetradeuterio-3-methyl-6,7-dihydronaphthalen-2-yl)pyridin-1-ium.
| Compound Name | 5-tert-butyl-1-methyl-2-(5,5,8,8-tetradeuterio-3-methyl-6,7-dihydronaphthalen-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 177074933 |
| Molecular Formula | C21H28N+ |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 5-tert-butyl-1-methyl-2-(5,5,8,8-tetradeuterio-3-methyl-6,7-dihydronaphthalen-2-yl)pyridin-1-ium |
| SMILES | [2H]C1([2H])CCC([2H])([2H])c2cc(-c3ccc(C(C)(C)C)c[n+]3C)c(C)cc21 |
| InChI | InChI=1S/C21H28N/c1-15-12-16-8-6-7-9-17(16)13-19(15)20-11-10-18(14-22(20)5)21(2,3)4/h10-14H,6-9H2,1-5H3/q+1/i8D2,9D2 |
| InChIKey | SFFGBYPLJHVOOI-LZMSFWOYSA-N |
| XLogP | 4.66 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|