C40H56N+ — CID 177270944
5-tert-butyl-1-methyl-2-[2-methyl-5-(1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracen-9-yl)-4-(trideuteriomethyl)phenyl]pyridin-1-ium (PubChem CID 177270944) has the molecular formula C40H56N+ and a molecular weight of 553.91 g/mol. Its IUPAC name is 5-tert-butyl-1-methyl-2-[2-methyl-5-(1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracen-9-yl)-4-(trideuteriomethyl)phenyl]pyridin-1-ium.
| Compound Name | 5-tert-butyl-1-methyl-2-[2-methyl-5-(1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracen-9-yl)-4-(trideuteriomethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 177270944 |
| Molecular Formula | C40H56N+ |
| Molecular Weight | 553.91 g/mol |
| Exact Mass | 553.46 |
| IUPAC Name | 5-tert-butyl-1-methyl-2-[2-methyl-5-(1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracen-9-yl)-4-(trideuteriomethyl)phenyl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2ccc(C(C)(C)C)c[n+]2C)cc1-c1c2c(cc3c1C(C)(C)CCC3(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C40H56N/c1-25-21-26(2)29(22-28(25)32-16-15-27(24-41(32)14)36(3,4)5)33-34-30(37(6,7)17-19-39(34,10)11)23-31-35(33)40(12,13)20-18-38(31,8)9/h15-16,21-24H,17-20H2,1-14H3/q+1/i2D3 |
| InChIKey | WLXDGCRZHZADRS-BMSJAHLVSA-N |
| XLogP | 10.46 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.91 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|