C36H48N+ — CID 177271015
1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]-4-(1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracen-9-yl)pyridin-1-ium (PubChem CID 177271015) has the molecular formula C36H48N+ and a molecular weight of 497.81 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]-4-(1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracen-9-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]-4-(1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracen-9-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 177271015 |
| Molecular Formula | C36H48N+ |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.40 |
| IUPAC Name | 1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]-4-(1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracen-9-yl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cc(-c3c4c(cc5c3C(C)(C)CCC5(C)C)C(C)(C)CCC4(C)C)cc[n+]2C)c(C)c1 |
| InChI | InChI=1S/C36H48N/c1-23-12-13-26(24(2)20-23)29-21-25(14-19-37(29)11)30-31-27(33(3,4)15-17-35(31,7)8)22-28-32(30)36(9,10)18-16-34(28,5)6/h12-14,19-22H,15-18H2,1-11H3/q+1/i1D3 |
| InChIKey | VXTADXOUWDWKEE-FIBGUPNXSA-N |
| XLogP | 9.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|