C23H32N+ — CID 155773454
1-methyl-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4,5-bis(trideuteriomethyl)pyridin-1-ium (PubChem CID 155773454) has the molecular formula C23H32N+ and a molecular weight of 328.55 g/mol. Its IUPAC name is 1-methyl-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4,5-bis(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4,5-bis(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 155773454 |
| Molecular Formula | C23H32N+ |
| Molecular Weight | 328.55 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 1-methyl-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4,5-bis(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(-c2cc3c(cc2C)C(C)(C)CCC3(C)C)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C23H32N/c1-15-12-21(24(8)14-17(15)3)18-13-20-19(11-16(18)2)22(4,5)9-10-23(20,6)7/h11-14H,9-10H2,1-8H3/q+1/i1D3,3D3 |
| InChIKey | XTYNTQORBSCVAF-WTJPRRJNSA-N |
| XLogP | 5.45 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|