C17H22N+ — CID 169046519
1-methyl-2-[2-methyl-4,6-bis(trideuteriomethyl)phenyl]-4,5-bis(trideuteriomethyl)pyridin-1-ium (PubChem CID 169046519) has the molecular formula C17H22N+ and a molecular weight of 252.44 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-4,6-bis(trideuteriomethyl)phenyl]-4,5-bis(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-4,6-bis(trideuteriomethyl)phenyl]-4,5-bis(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 169046519 |
| Molecular Formula | C17H22N+ |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | 1-methyl-2-[2-methyl-4,6-bis(trideuteriomethyl)phenyl]-4,5-bis(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])c[n+]2C)c(C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C17H22N/c1-11-7-13(3)17(14(4)8-11)16-9-12(2)15(5)10-18(16)6/h7-10H,1-6H3/q+1/i1D3,2D3,3D3,5D3 |
| InChIKey | RSKFMKNYVLIFPM-YRBNFMKKSA-N |
| XLogP | 3.72 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|