C20H29FNSi+ — CID 167365239
[4-(2-deuteriopropan-2-yl)-6-[2-fluoro-6-methyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 167365239) has the molecular formula C20H29FNSi+ and a molecular weight of 334.57 g/mol. Its IUPAC name is [4-(2-deuteriopropan-2-yl)-6-[2-fluoro-6-methyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [4-(2-deuteriopropan-2-yl)-6-[2-fluoro-6-methyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 167365239 |
| Molecular Formula | C20H29FNSi+ |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | [4-(2-deuteriopropan-2-yl)-6-[2-fluoro-6-methyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(C([2H])(C)C)c([Si](C)(C)C)c[n+]2C)c(F)c1 |
| InChI | InChI=1S/C20H29FNSi/c1-13(2)16-11-18(22(5)12-19(16)23(6,7)8)20-15(4)9-14(3)10-17(20)21/h9-13H,1-8H3/q+1/i3D3,13D |
| InChIKey | KORIAIOCDAGTEB-SNOBMXNVSA-N |
| XLogP | 4.60 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|