C19H26N+ — CID 140878082
4,5-bis(2-deuteriopropan-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 140878082) has the molecular formula C19H26N+ and a molecular weight of 270.44 g/mol. Its IUPAC name is 4,5-bis(2-deuteriopropan-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 4,5-bis(2-deuteriopropan-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140878082 |
| Molecular Formula | C19H26N+ |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 4,5-bis(2-deuteriopropan-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | [2H]C(C)(C)c1cc(-c2ccccc2C)[n+](C)cc1C([2H])(C)C |
| InChI | InChI=1S/C19H26N/c1-13(2)17-11-19(16-10-8-7-9-15(16)5)20(6)12-18(17)14(3)4/h7-14H,1-6H3/q+1/i13D,14D |
| InChIKey | UVSMVOLVXXMTKQ-FLZZRPEZSA-N |
| XLogP | 4.73 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|