C18H24N+ — CID 157088758
4-ethyl-1-methyl-2-(2-methylphenyl)-5-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium (PubChem CID 157088758) has the molecular formula C18H24N+ and a molecular weight of 258.42 g/mol. Its IUPAC name is 4-ethyl-1-methyl-2-(2-methylphenyl)-5-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium.
| Compound Name | 4-ethyl-1-methyl-2-(2-methylphenyl)-5-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 157088758 |
| Molecular Formula | C18H24N+ |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 4-ethyl-1-methyl-2-(2-methylphenyl)-5-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(C)c1c[n+](C)c(-c2ccccc2C)cc1CC |
| InChI | InChI=1S/C18H24N/c1-6-15-11-18(16-10-8-7-9-14(16)4)19(5)12-17(15)13(2)3/h7-13H,6H2,1-5H3/q+1/i2D3,13D |
| InChIKey | PJQXFUMHJZGQGP-JIBPXCTFSA-N |
| XLogP | 4.17 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|