C19H26NS+ — CID 176724383
5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-(2-methylphenyl)-4-propan-2-ylsulfanylpyridin-1-ium (PubChem CID 176724383) has the molecular formula C19H26NS+ and a molecular weight of 307.53 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-(2-methylphenyl)-4-propan-2-ylsulfanylpyridin-1-ium.
| Compound Name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-(2-methylphenyl)-4-propan-2-ylsulfanylpyridin-1-ium |
|---|---|
| PubChem CID | 176724383 |
| Molecular Formula | C19H26NS+ |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-(2-methylphenyl)-4-propan-2-ylsulfanylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(c1c[n+](C)c(-c2ccccc2C)cc1SC(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C19H26NS/c1-13(2)17-12-20(6)18(11-19(17)21-14(3)4)16-10-8-7-9-15(16)5/h7-14H,1-6H3/q+1/i1D3,2D3,13D |
| InChIKey | ZYJTUHUQGWIFCR-GYDXGMDDSA-N |
| XLogP | 5.11 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|