C18H22N+ — CID 170685276
2,6,6-trimethyl-3-(2-methylphenyl)-5,7-dihydrocyclopenta[c]pyridin-2-ium (PubChem CID 170685276) has the molecular formula C18H22N+ and a molecular weight of 252.38 g/mol. Its IUPAC name is 2,6,6-trimethyl-3-(2-methylphenyl)-5,7-dihydrocyclopenta[c]pyridin-2-ium.
| Compound Name | 2,6,6-trimethyl-3-(2-methylphenyl)-5,7-dihydrocyclopenta[c]pyridin-2-ium |
|---|---|
| PubChem CID | 170685276 |
| Molecular Formula | C18H22N+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2,6,6-trimethyl-3-(2-methylphenyl)-5,7-dihydrocyclopenta[c]pyridin-2-ium |
| SMILES | Cc1ccccc1-c1cc2c(c[n+]1C)CC(C)(C)C2 |
| InChI | InChI=1S/C18H22N/c1-13-7-5-6-8-16(13)17-9-14-10-18(2,3)11-15(14)12-19(17)4/h5-9,12H,10-11H2,1-4H3/q+1 |
| InChIKey | LPXWZGDKBQHDMB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|