C13H13FN+ — CID 123794284
5-fluoro-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 123794284) has the molecular formula C13H13FN+ and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-fluoro-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 5-fluoro-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 123794284 |
| Molecular Formula | C13H13FN+ |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5-fluoro-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | Cc1ccccc1-c1ccc(F)c[n+]1C |
| InChI | InChI=1S/C13H13FN/c1-10-5-3-4-6-12(10)13-8-7-11(14)9-15(13)2/h3-9H,1-2H3/q+1 |
| InChIKey | WVJHFEAWLYUFFI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|