C17H22N+ — CID 59773314
4-tert-butyl-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 59773314) has the molecular formula C17H22N+ and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-tert-butyl-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 4-tert-butyl-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 59773314 |
| Molecular Formula | C17H22N+ |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-tert-butyl-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | Cc1ccccc1-c1cc(C(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C17H22N/c1-13-8-6-7-9-15(13)16-12-14(17(2,3)4)10-11-18(16)5/h6-12H,1-5H3/q+1 |
| InChIKey | IUUPOHBPNVYEIK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|