C20H28N+ — CID 159726150
2-(4-tert-butyl-2-methylphenyl)-1-methyl-4-propan-2-ylpyridin-1-ium (PubChem CID 159726150) has the molecular formula C20H28N+ and a molecular weight of 282.45 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-methylphenyl)-1-methyl-4-propan-2-ylpyridin-1-ium.
| Compound Name | 2-(4-tert-butyl-2-methylphenyl)-1-methyl-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 159726150 |
| Molecular Formula | C20H28N+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-(4-tert-butyl-2-methylphenyl)-1-methyl-4-propan-2-ylpyridin-1-ium |
| SMILES | Cc1cc(C(C)(C)C)ccc1-c1cc(C(C)C)cc[n+]1C |
| InChI | InChI=1S/C20H28N/c1-14(2)16-10-11-21(7)19(13-16)18-9-8-17(12-15(18)3)20(4,5)6/h8-14H,1-7H3/q+1 |
| InChIKey | MHKLDJOVMBGDTL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|