C24H36N+ — CID 167365541
2-(5-tert-butyl-2-methylphenyl)-4-(3-deuterio-2,4-dimethylpentan-3-yl)-1-methylpyridin-1-ium (PubChem CID 167365541) has the molecular formula C24H36N+ and a molecular weight of 339.57 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-methylphenyl)-4-(3-deuterio-2,4-dimethylpentan-3-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(5-tert-butyl-2-methylphenyl)-4-(3-deuterio-2,4-dimethylpentan-3-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 167365541 |
| Molecular Formula | C24H36N+ |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | 2-(5-tert-butyl-2-methylphenyl)-4-(3-deuterio-2,4-dimethylpentan-3-yl)-1-methylpyridin-1-ium |
| SMILES | [2H]C(c1cc[n+](C)c(-c2cc(C(C)(C)C)ccc2C)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H36N/c1-16(2)23(17(3)4)19-12-13-25(9)22(14-19)21-15-20(24(6,7)8)11-10-18(21)5/h10-17,23H,1-9H3/q+1/i23D |
| InChIKey | CNAYBJWHBSGCLW-WBQFYUNPSA-N |
| XLogP | 6.18 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|