C33H46N+ — CID 140777935
4-[3,5-bis(3-deuterio-2,4-dimethylpentan-3-yl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 140777935) has the molecular formula C33H46N+ and a molecular weight of 458.75 g/mol. Its IUPAC name is 4-[3,5-bis(3-deuterio-2,4-dimethylpentan-3-yl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 4-[3,5-bis(3-deuterio-2,4-dimethylpentan-3-yl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140777935 |
| Molecular Formula | C33H46N+ |
| Molecular Weight | 458.75 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | 4-[3,5-bis(3-deuterio-2,4-dimethylpentan-3-yl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | [2H]C(c1cc(-c2cc[n+](C)c(-c3ccccc3C)c2)cc(C([2H])(C(C)C)C(C)C)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H46N/c1-21(2)32(22(3)4)28-17-27(18-29(19-28)33(23(5)6)24(7)8)26-15-16-34(10)31(20-26)30-14-12-11-13-25(30)9/h11-24,32-33H,1-10H3/q+1/i32D,33D |
| InChIKey | ISRGDKKQGIWVHF-AWBUEKCLSA-N |
| XLogP | 8.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.75 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|