C28H34N+ — CID 166563835
4-[4-(1-deuterio-3,3,4,4-tetramethylcyclopentyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 166563835) has the molecular formula C28H34N+ and a molecular weight of 385.59 g/mol. Its IUPAC name is 4-[4-(1-deuterio-3,3,4,4-tetramethylcyclopentyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 4-[4-(1-deuterio-3,3,4,4-tetramethylcyclopentyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 166563835 |
| Molecular Formula | C28H34N+ |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 4-[4-(1-deuterio-3,3,4,4-tetramethylcyclopentyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3cc[n+](C)c(-c4ccccc4C)c3)cc2)CC(C)(C)C(C)(C)C1 |
| InChI | InChI=1S/C28H34N/c1-20-9-7-8-10-25(20)26-17-23(15-16-29(26)6)21-11-13-22(14-12-21)24-18-27(2,3)28(4,5)19-24/h7-17,24H,18-19H2,1-6H3/q+1/i24D |
| InChIKey | GLSAZETZVGTPQK-CORJAIEOSA-N |
| XLogP | 7.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|