C26H30N+ — CID 161092221
4-[4-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 161092221) has the molecular formula C26H30N+ and a molecular weight of 366.59 g/mol. Its IUPAC name is 4-[4-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 4-[4-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 161092221 |
| Molecular Formula | C26H30N+ |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | 4-[4-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])(c2ccc(-c3cc[n+](C)c(-c4ccccc4C)c3)cc2)C([2H])([2H])C([2H])([2H])C1([2H])C |
| InChI | InChI=1S/C26H30N/c1-19-8-10-21(11-9-19)22-12-14-23(15-13-22)24-16-17-27(3)26(18-24)25-7-5-4-6-20(25)2/h4-7,12-19,21H,8-11H2,1-3H3/q+1/i8D2,9D2,10D2,11D2,19D,21D |
| InChIKey | CDBBSNSOBSCMFA-LNVFNEFBSA-N |
| XLogP | 6.45 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|