C26H28N+ — CID 166564143
4-[4-(3-deuterio-3-bicyclo[3.1.1]heptanyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 166564143) has the molecular formula C26H28N+ and a molecular weight of 355.52 g/mol. Its IUPAC name is 4-[4-(3-deuterio-3-bicyclo[3.1.1]heptanyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 4-[4-(3-deuterio-3-bicyclo[3.1.1]heptanyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 166564143 |
| Molecular Formula | C26H28N+ |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 4-[4-(3-deuterio-3-bicyclo[3.1.1]heptanyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3cc[n+](C)c(-c4ccccc4C)c3)cc2)CC2CC(C2)C1 |
| InChI | InChI=1S/C26H28N/c1-18-5-3-4-6-25(18)26-17-23(11-12-27(26)2)21-7-9-22(10-8-21)24-15-19-13-20(14-19)16-24/h3-12,17,19-20,24H,13-16H2,1-2H3/q+1/i24D |
| InChIKey | AEWCNWYIRDCOAC-CORJAIEOSA-N |
| XLogP | 6.06 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|