C39H30N+ — CID 140861393
4-(1,8-dideuterio-11-phenyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 140861393) has the molecular formula C39H30N+ and a molecular weight of 514.69 g/mol. Its IUPAC name is 4-(1,8-dideuterio-11-phenyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 4-(1,8-dideuterio-11-phenyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140861393 |
| Molecular Formula | C39H30N+ |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 4-(1,8-dideuterio-11-phenyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | [2H]C12c3ccccc3C([2H])(c3ccc(-c4ccccc4)cc31)c1cc(-c3cc[n+](C)c(-c4ccccc4C)c3)ccc12 |
| InChI | InChI=1S/C39H30N/c1-25-10-6-7-13-30(25)37-24-29(20-21-40(37)2)28-17-19-34-36(23-28)39-32-15-9-8-14-31(32)38(34)35-22-27(16-18-33(35)39)26-11-4-3-5-12-26/h3-24,38-39H,1-2H3/q+1/i38D,39D |
| InChIKey | YOPXBZHJEFSQRT-HUAHIRJZSA-N |
| XLogP | 8.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|