C33H26N+ — CID 140861421
2-(1,8-dideuterio-5-methyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15,17,19-nonaenyl)-1-methyl-4-phenylpyridin-1-ium (PubChem CID 140861421) has the molecular formula C33H26N+ and a molecular weight of 438.59 g/mol. Its IUPAC name is 2-(1,8-dideuterio-5-methyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15,17,19-nonaenyl)-1-methyl-4-phenylpyridin-1-ium.
| Compound Name | 2-(1,8-dideuterio-5-methyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15,17,19-nonaenyl)-1-methyl-4-phenylpyridin-1-ium |
|---|---|
| PubChem CID | 140861421 |
| Molecular Formula | C33H26N+ |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-(1,8-dideuterio-5-methyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15,17,19-nonaenyl)-1-methyl-4-phenylpyridin-1-ium |
| SMILES | [2H]C12c3ccccc3C([2H])(c3ccccc31)c1cc(-c3cc(-c4ccccc4)cc[n+]3C)c(C)cc12 |
| InChI | InChI=1S/C33H26N/c1-21-18-29-30(20-28(21)31-19-23(16-17-34(31)2)22-10-4-3-5-11-22)33-26-14-8-6-12-24(26)32(29)25-13-7-9-15-27(25)33/h3-20,32-33H,1-2H3/q+1/i32D,33D |
| InChIKey | IDHHXKVFRDMPDJ-AWBUEKCLSA-N |
| XLogP | 7.14 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|