C27H26N+ — CID 140920657
1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-[2-(trideuteriomethyl)phenyl]pyridin-1-ium (PubChem CID 140920657) has the molecular formula C27H26N+ and a molecular weight of 370.55 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-[2-(trideuteriomethyl)phenyl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-[2-(trideuteriomethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 140920657 |
| Molecular Formula | C27H26N+ |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-methyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-4-[2-(trideuteriomethyl)phenyl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccccc1-c1cc[n+](C)c(-c2cc(-c3ccccc3)c(C([2H])([2H])[2H])cc2C)c1 |
| InChI | InChI=1S/C27H26N/c1-19-10-8-9-13-24(19)23-14-15-28(4)27(17-23)26-18-25(20(2)16-21(26)3)22-11-6-5-7-12-22/h5-18H,1-4H3/q+1/i1D3,2D3 |
| InChIKey | RCXRYJFZFZPWAQ-WFGJKAKNSA-N |
| XLogP | 6.44 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|