C24H30NSi+ — CID 163545923
[1,4-dimethyl-6-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 163545923) has the molecular formula C24H30NSi+ and a molecular weight of 363.62 g/mol. Its IUPAC name is [1,4-dimethyl-6-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [1,4-dimethyl-6-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 163545923 |
| Molecular Formula | C24H30NSi+ |
| Molecular Weight | 363.62 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [1,4-dimethyl-6-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(C)c([Si](C)(C)C)c[n+]2C)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H30NSi/c1-17-13-18(2)22(15-21(17)20-11-9-8-10-12-20)23-14-19(3)24(16-25(23)4)26(5,6)7/h8-16H,1-7H3/q+1/i1D3 |
| InChIKey | ZTPYIWCPTXNKMN-FIBGUPNXSA-N |
| XLogP | 5.32 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|