C27H38NSi2+ — CID 163850942
[1,4-dimethyl-6-[2-methyl-5-(4-methylphenyl)-4-trimethylsilylphenyl]pyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 163850942) has the molecular formula C27H38NSi2+ and a molecular weight of 432.78 g/mol. Its IUPAC name is [1,4-dimethyl-6-[2-methyl-5-(4-methylphenyl)-4-trimethylsilylphenyl]pyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [1,4-dimethyl-6-[2-methyl-5-(4-methylphenyl)-4-trimethylsilylphenyl]pyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 163850942 |
| Molecular Formula | C27H38NSi2+ |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [1,4-dimethyl-6-[2-methyl-5-(4-methylphenyl)-4-trimethylsilylphenyl]pyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | Cc1ccc(-c2cc(-c3cc(C)c([Si](C)(C)C)c[n+]3C)c(C)cc2[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C27H38NSi2/c1-19-11-13-22(14-12-19)24-17-23(20(2)16-26(24)29(5,6)7)25-15-21(3)27(18-28(25)4)30(8,9)10/h11-18H,1-10H3/q+1 |
| InChIKey | AGXPRVGPIWTOHV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|