C22H24N+ — CID 140920741
2-[2,4-dimethyl-5-(4-methylphenyl)phenyl]-1,4-dimethylpyridin-1-ium (PubChem CID 140920741) has the molecular formula C22H24N+ and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-[2,4-dimethyl-5-(4-methylphenyl)phenyl]-1,4-dimethylpyridin-1-ium.
| Compound Name | 2-[2,4-dimethyl-5-(4-methylphenyl)phenyl]-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 140920741 |
| Molecular Formula | C22H24N+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2-[2,4-dimethyl-5-(4-methylphenyl)phenyl]-1,4-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2cc(-c3cc(C)cc[n+]3C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C22H24N/c1-15-6-8-19(9-7-15)20-14-21(18(4)13-17(20)3)22-12-16(2)10-11-23(22)5/h6-14H,1-5H3/q+1 |
| InChIKey | GHPHZEVGELWXQB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|