C22H20N+ — CID 159036743
1,4-dimethyl-2-(2-methylphenanthren-3-yl)pyridin-1-ium (PubChem CID 159036743) has the molecular formula C22H20N+ and a molecular weight of 298.41 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2-methylphenanthren-3-yl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-(2-methylphenanthren-3-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 159036743 |
| Molecular Formula | C22H20N+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1,4-dimethyl-2-(2-methylphenanthren-3-yl)pyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2cc3c(ccc4ccccc43)cc2C)c1 |
| InChI | InChI=1S/C22H20N/c1-15-10-11-23(3)22(12-15)20-14-21-18(13-16(20)2)9-8-17-6-4-5-7-19(17)21/h4-14H,1-3H3/q+1 |
| InChIKey | SNCLVGHREXBYGR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|