C24H20NO+ — CID 157313577
1,4-dimethyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-8-yl)pyridin-1-ium (PubChem CID 157313577) has the molecular formula C24H20NO+ and a molecular weight of 338.43 g/mol. Its IUPAC name is 1,4-dimethyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-8-yl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 157313577 |
| Molecular Formula | C24H20NO+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1,4-dimethyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-8-yl)pyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2cc3c(cc2C)oc2c4ccccc4ccc32)c1 |
| InChI | InChI=1S/C24H20NO/c1-15-10-11-25(3)22(12-15)20-14-21-19-9-8-17-6-4-5-7-18(17)24(19)26-23(21)13-16(20)2/h4-14H,1-3H3/q+1 |
| InChIKey | ULOWDHRJZWXVJQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|