C30H32N+ — CID 140940633
1,4-dimethyl-2-(3,11,11,12,12-pentamethylchrysen-2-yl)pyridin-1-ium (PubChem CID 140940633) has the molecular formula C30H32N+ and a molecular weight of 406.59 g/mol. Its IUPAC name is 1,4-dimethyl-2-(3,11,11,12,12-pentamethylchrysen-2-yl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-(3,11,11,12,12-pentamethylchrysen-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 140940633 |
| Molecular Formula | C30H32N+ |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1,4-dimethyl-2-(3,11,11,12,12-pentamethylchrysen-2-yl)pyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2cc3c(cc2C)-c2ccc4ccccc4c2C(C)(C)C3(C)C)c1 |
| InChI | InChI=1S/C30H32N/c1-19-14-15-31(7)27(16-19)24-18-26-25(17-20(24)2)23-13-12-21-10-8-9-11-22(21)28(23)30(5,6)29(26,3)4/h8-18H,1-7H3/q+1 |
| InChIKey | FEENUOHKDHCMCD-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|