C30H32N+ — CID 140940624
1-methyl-2-(2,11,11,12,12-pentamethylchrysen-3-yl)-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 140940624) has the molecular formula C30H32N+ and a molecular weight of 409.61 g/mol. Its IUPAC name is 1-methyl-2-(2,11,11,12,12-pentamethylchrysen-3-yl)-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(2,11,11,12,12-pentamethylchrysen-3-yl)-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140940624 |
| Molecular Formula | C30H32N+ |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 1-methyl-2-(2,11,11,12,12-pentamethylchrysen-3-yl)-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cc3c(cc2C)C(C)(C)C(C)(C)c2c-3ccc3ccccc23)[n+](C)c1 |
| InChI | InChI=1S/C30H32N/c1-19-12-15-27(31(7)18-19)24-17-25-23-14-13-21-10-8-9-11-22(21)28(23)30(5,6)29(3,4)26(25)16-20(24)2/h8-18H,1-7H3/q+1/i1D3 |
| InChIKey | SYSZDUQFYZRBAS-FIBGUPNXSA-N |
| XLogP | 7.18 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|