C28H30NY- — CID 140940687
1-methyl-2-(3,5,5,6,6-pentamethyl-8-phenyl-7H-naphthalen-7-id-2-yl)-5-(trideuteriomethyl)pyridin-1-ium;yttrium (PubChem CID 140940687) has the molecular formula C28H30NY- and a molecular weight of 472.48 g/mol. Its IUPAC name is 1-methyl-2-(3,5,5,6,6-pentamethyl-8-phenyl-7H-naphthalen-7-id-2-yl)-5-(trideuteriomethyl)pyridin-1-ium;yttrium.
| Compound Name | 1-methyl-2-(3,5,5,6,6-pentamethyl-8-phenyl-7H-naphthalen-7-id-2-yl)-5-(trideuteriomethyl)pyridin-1-ium;yttrium |
|---|---|
| PubChem CID | 140940687 |
| Molecular Formula | C28H30NY- |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-methyl-2-(3,5,5,6,6-pentamethyl-8-phenyl-7H-naphthalen-7-id-2-yl)-5-(trideuteriomethyl)pyridin-1-ium;yttrium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cc3c(cc2C)C(C)(C)C(C)(C)[C-]=C3c2[c-]cccc2)[n+](C)c1.[Y] |
| InChI | InChI=1S/C28H30N.Y/c1-19-13-14-26(29(7)18-19)22-16-23-24(21-11-9-8-10-12-21)17-27(3,4)28(5,6)25(23)15-20(22)2;/h8-11,13-16,18H,1-7H3;/q-1;/i1D3; |
| InChIKey | NBVTZMFYSTXLTO-NIIDSAIPSA-N |
| XLogP | 6.14 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|