C20H20N+ — CID 58240297
1,5-dimethyl-2-(2-methyl-4-phenylphenyl)pyridin-1-ium (PubChem CID 58240297) has the molecular formula C20H20N+ and a molecular weight of 274.39 g/mol. Its IUPAC name is 1,5-dimethyl-2-(2-methyl-4-phenylphenyl)pyridin-1-ium.
| Compound Name | 1,5-dimethyl-2-(2-methyl-4-phenylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 58240297 |
| Molecular Formula | C20H20N+ |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1,5-dimethyl-2-(2-methyl-4-phenylphenyl)pyridin-1-ium |
| SMILES | Cc1ccc(-c2ccc(-c3ccccc3)cc2C)[n+](C)c1 |
| InChI | InChI=1S/C20H20N/c1-15-9-12-20(21(3)14-15)19-11-10-18(13-16(19)2)17-7-5-4-6-8-17/h4-14H,1-3H3/q+1 |
| InChIKey | FDRRGXDNESEUDX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|