C21H22N+ — CID 167346400
1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]-5-[4-(trideuteriomethyl)phenyl]pyridin-1-ium (PubChem CID 167346400) has the molecular formula C21H22N+ and a molecular weight of 294.45 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]-5-[4-(trideuteriomethyl)phenyl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]-5-[4-(trideuteriomethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 167346400 |
| Molecular Formula | C21H22N+ |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]-5-[4-(trideuteriomethyl)phenyl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccc(-c3ccc(C([2H])([2H])[2H])cc3C)[n+](C)c2)cc1 |
| InChI | InChI=1S/C21H22N/c1-15-5-8-18(9-6-15)19-10-12-21(22(4)14-19)20-11-7-16(2)13-17(20)3/h5-14H,1-4H3/q+1/i1D3,2D3 |
| InChIKey | PQXRCKFWAONOFZ-WFGJKAKNSA-N |
| XLogP | 4.77 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|