C17H22N+ — CID 155773460
5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium (PubChem CID 155773460) has the molecular formula C17H22N+ and a molecular weight of 250.43 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium.
| Compound Name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 155773460 |
| Molecular Formula | C17H22N+ |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccc(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c[n+]2C)c(C)c1 |
| InChI | InChI=1S/C17H22N/c1-12(2)15-7-9-17(18(5)11-15)16-8-6-13(3)10-14(16)4/h6-12H,1-5H3/q+1/i1D3,2D3,3D3,12D |
| InChIKey | JZOWONPXRWWAER-FWDWGVSGSA-N |
| XLogP | 3.92 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|