C16H20N+ — CID 158988048
2-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methylphenyl]-1-methylpyridin-1-ium (PubChem CID 158988048) has the molecular formula C16H20N+ and a molecular weight of 233.39 g/mol. Its IUPAC name is 2-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methylphenyl]-1-methylpyridin-1-ium.
| Compound Name | 2-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methylphenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 158988048 |
| Molecular Formula | C16H20N+ |
| Molecular Weight | 233.39 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 2-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methylphenyl]-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(c1ccc(-c2cccc[n+]2C)c(C)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H20N/c1-12(2)14-8-9-15(13(3)11-14)16-7-5-6-10-17(16)4/h5-12H,1-4H3/q+1/i1D3,2D3,12D |
| InChIKey | QDLLMIOOJPMDSV-QLWPOVNFSA-N |
| XLogP | 3.61 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|