C15H18N+ — CID 158240011
2-[2,3-dimethyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium (PubChem CID 158240011) has the molecular formula C15H18N+ and a molecular weight of 215.33 g/mol. Its IUPAC name is 2-[2,3-dimethyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium.
| Compound Name | 2-[2,3-dimethyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 158240011 |
| Molecular Formula | C15H18N+ |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-[2,3-dimethyl-4-(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cccc[n+]2C)c(C)c1C |
| InChI | InChI=1S/C15H18N/c1-11-8-9-14(13(3)12(11)2)15-7-5-6-10-16(15)4/h5-10H,1-4H3/q+1/i1D3 |
| InChIKey | OGYUGGWJDXEUOH-FIBGUPNXSA-N |
| XLogP | 3.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|