C14H13N2+ — CID 176621919
2-(4-isocyano-2-methylphenyl)-1-methylpyridin-1-ium (PubChem CID 176621919) has the molecular formula C14H13N2+ and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-(4-isocyano-2-methylphenyl)-1-methylpyridin-1-ium.
| Compound Name | 2-(4-isocyano-2-methylphenyl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 176621919 |
| Molecular Formula | C14H13N2+ |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(4-isocyano-2-methylphenyl)-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc(-c2cccc[n+]2C)c(C)c1 |
| InChI | InChI=1S/C14H13N2/c1-11-10-12(15-2)7-8-13(11)14-6-4-5-9-16(14)3/h4-10H,1,3H3/q+1 |
| InChIKey | KYXIEYSXLUMRKJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|