C26H36N+ — CID 140720316
1-methyl-2-(1,5,8,9,9,10,10,11,11-nonamethyl-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyridin-1-ium (PubChem CID 140720316) has the molecular formula C26H36N+ and a molecular weight of 362.58 g/mol. Its IUPAC name is 1-methyl-2-(1,5,8,9,9,10,10,11,11-nonamethyl-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(1,5,8,9,9,10,10,11,11-nonamethyl-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140720316 |
| Molecular Formula | C26H36N+ |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1-methyl-2-(1,5,8,9,9,10,10,11,11-nonamethyl-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyridin-1-ium |
| SMILES | Cc1cc2c(cc1-c1cccc[n+]1C)C1(C)C(C)(C)C(C)(C)C2(C)C1(C)C |
| InChI | InChI=1S/C26H36N/c1-17-15-19-20(16-18(17)21-13-11-12-14-27(21)10)26(9)23(4,5)22(2,3)25(19,8)24(26,6)7/h11-16H,1-10H3/q+1 |
| InChIKey | NKJZHYVYKNUOIV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|