About 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium
1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium (PubChem CID 162062988) has the molecular formula C25H28N+
and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium.
Molecular Properties
| Compound Name | 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium |
| PubChem CID | 162062988 |
| Molecular Formula | C25H28N+ |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium |
| SMILES | Cc1cc2c(cc1-c1cccc[n+]1C)-c1cccc(C(C)C)c1C2(C)C |
| InChI | InChI=1S/C25H28N/c1-16(2)18-10-9-11-19-21-15-20(23-12-7-8-13-26(23)6)17(3)14-22(21)25(4,5)24(18)19/h7-16H,1-6H3/q+1 |
| InChIKey | YWCVSDZUBFKSPI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium?
The IUPAC name of 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium (CID 162062988) is 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium.
What is the SMILES notation for 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium?
The canonical SMILES for 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium is Cc1cc2c(cc1-c1cccc[n+]1C)-c1cccc(C(C)C)c1C2(C)C.
What is the InChIKey of 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium?
The InChIKey is YWCVSDZUBFKSPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N/c1-16(2)18-10-9-11-19-21-15-20(23-12-7-8-13-26(23)6)17(3)14-22(21)25(4,5)24(18)19/h7-16H,1-6H3/q+1.
What are the key properties of 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium?
1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium has a molecular weight of 342.51 g/mol, XLogP of 5.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(2,9,9-trimethyl-8-propan-2-ylfluoren-3-yl)pyridin-1-ium is sourced from PubChem (CID 162062988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).