C31H36N3+ — CID 123277893
6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7,9,9-trimethylindeno[2,1-b]pyridine (PubChem CID 123277893) has the molecular formula C31H36N3+ and a molecular weight of 450.65 g/mol. Its IUPAC name is 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7,9,9-trimethylindeno[2,1-b]pyridine.
| Compound Name | 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7,9,9-trimethylindeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 123277893 |
| Molecular Formula | C31H36N3+ |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7,9,9-trimethylindeno[2,1-b]pyridine |
| SMILES | Cc1cc2c(cc1-c1n(-c3c(C(C)C)cccc3C(C)C)cc[n+]1C)-c1cccnc1C2(C)C |
| InChI | InChI=1S/C31H36N3/c1-19(2)22-11-9-12-23(20(3)4)28(22)34-16-15-33(8)30(34)25-18-26-24-13-10-14-32-29(24)31(6,7)27(26)17-21(25)5/h9-20H,1-8H3/q+1 |
| InChIKey | GRDYMGOJCXQZGU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|