C29H30IrN3- — CID 140877720
8-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]-9,9-dimethyl-7H-indeno[2,1-b]pyridin-7-ide;iridium (PubChem CID 140877720) has the molecular formula C29H30IrN3- and a molecular weight of 612.80 g/mol. Its IUPAC name is 8-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]-9,9-dimethyl-7H-indeno[2,1-b]pyridin-7-ide;iridium.
| Compound Name | 8-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]-9,9-dimethyl-7H-indeno[2,1-b]pyridin-7-ide;iridium |
|---|---|
| PubChem CID | 140877720 |
| Molecular Formula | C29H30IrN3- |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | 8-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]-9,9-dimethyl-7H-indeno[2,1-b]pyridin-7-ide;iridium |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]ccc2c1C(C)(C)c1ncccc1-2.[Ir] |
| InChI | InChI=1S/C29H30N3.Ir/c1-18(2)20-10-7-11-21(19(3)4)26(20)32-17-16-31-28(32)24-13-8-12-22-23-14-9-15-30-27(23)29(5,6)25(22)24;/h7-12,14-19H,1-6H3;/q-1; |
| InChIKey | XTOLTOYHRBFTAD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|