C23H26N2O2 — CID 72696305
methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate (PubChem CID 72696305) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate.
| Compound Name | methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate |
|---|---|
| PubChem CID | 72696305 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nccn2-c2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-15(2)19-7-6-8-20(16(3)4)21(19)25-14-13-24-22(25)17-9-11-18(12-10-17)23(26)27-5/h6-16H,1-5H3 |
| InChIKey | MUGSBBJTCRVLPE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |