methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate

C23H26N2O2 — CID 72696305

IUPACmethyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate
SMILESCOC(=O)c1ccc(-c2nccn2-c2c(C(C)C)cccc2C(C)C)cc1
InChIInChI=1S/C23H26N2O2/c1-15(2)19-7-6-8-20(16(3)4)21(19)25-14-13-24-22(25)17-9-11-18(12-10-17)23(26)27-5/h6-16H,1-5H3
InChIKeyMUGSBBJTCRVLPE-UHFFFAOYSA-N
MW362.47 g/mol
LogP5.57
Rot. Bonds5

About methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate

methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate (PubChem CID 72696305) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate.

Molecular Properties

Compound Namemethyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate
PubChem CID72696305
Molecular FormulaC23H26N2O2
Molecular Weight362.47 g/mol
Exact Mass362.20
IUPAC Namemethyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate
SMILESCOC(=O)c1ccc(-c2nccn2-c2c(C(C)C)cccc2C(C)C)cc1
InChIInChI=1S/C23H26N2O2/c1-15(2)19-7-6-8-20(16(3)4)21(19)25-14-13-24-22(25)17-9-11-18(12-10-17)23(26)27-5/h6-16H,1-5H3
InChIKeyMUGSBBJTCRVLPE-UHFFFAOYSA-N
XLogP5.57
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500362.47
LogP ≤ 55.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate?
The IUPAC name of methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate (CID 72696305) is methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate.
What is the SMILES notation for methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate?
The canonical SMILES for methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate is COC(=O)c1ccc(-c2nccn2-c2c(C(C)C)cccc2C(C)C)cc1.
What is the InChIKey of methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate?
The InChIKey is MUGSBBJTCRVLPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O2/c1-15(2)19-7-6-8-20(16(3)4)21(19)25-14-13-24-22(25)17-9-11-18(12-10-17)23(26)27-5/h6-16H,1-5H3.
What are the key properties of methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate?
methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate has a molecular weight of 362.47 g/mol, XLogP of 5.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]benzoate is sourced from PubChem (CID 72696305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).