C27H31N4+ — CID 160912710
6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7-methyl-4H-imidazo[1,2-a]indole (PubChem CID 160912710) has the molecular formula C27H31N4+ and a molecular weight of 411.57 g/mol. Its IUPAC name is 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7-methyl-4H-imidazo[1,2-a]indole.
| Compound Name | 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7-methyl-4H-imidazo[1,2-a]indole |
|---|---|
| PubChem CID | 160912710 |
| Molecular Formula | C27H31N4+ |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7-methyl-4H-imidazo[1,2-a]indole |
| SMILES | Cc1cc2c(cc1-c1n(-c3c(C(C)C)cccc3C(C)C)cc[n+]1C)Cc1nccn1-2 |
| InChI | InChI=1S/C27H31N4/c1-17(2)21-8-7-9-22(18(3)4)26(21)31-13-12-29(6)27(31)23-15-20-16-25-28-10-11-30(25)24(20)14-19(23)5/h7-15,17-18H,16H2,1-6H3/q+1 |
| InChIKey | KWEDXWYYIDGLAQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|