C31H33N4+ — CID 158354033
5-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-4H-imidazo[1,2-a]indole (PubChem CID 158354033) has the molecular formula C31H33N4+ and a molecular weight of 461.63 g/mol. Its IUPAC name is 5-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-4H-imidazo[1,2-a]indole.
| Compound Name | 5-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-4H-imidazo[1,2-a]indole |
|---|---|
| PubChem CID | 158354033 |
| Molecular Formula | C31H33N4+ |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 5-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-4H-imidazo[1,2-a]indole |
| SMILES | Cc1ccc2c(c1-c1n(-c3c(C(C)C)cccc3C(C)C)c3ccccc3[n+]1C)Cc1nccn1-2 |
| InChI | InChI=1S/C31H33N4/c1-19(2)22-10-9-11-23(20(3)4)30(22)35-27-13-8-7-12-26(27)33(6)31(35)29-21(5)14-15-25-24(29)18-28-32-16-17-34(25)28/h7-17,19-20H,18H2,1-6H3/q+1 |
| InChIKey | LSEOXVGVQZNRHR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|