C27H30FN2+ — CID 169026337
1-[2,6-di(propan-2-yl)phenyl]-2-(4-fluoro-2-methylphenyl)-3-methylbenzimidazol-3-ium (PubChem CID 169026337) has the molecular formula C27H30FN2+ and a molecular weight of 401.55 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2-(4-fluoro-2-methylphenyl)-3-methylbenzimidazol-3-ium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2-(4-fluoro-2-methylphenyl)-3-methylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 169026337 |
| Molecular Formula | C27H30FN2+ |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2-(4-fluoro-2-methylphenyl)-3-methylbenzimidazol-3-ium |
| SMILES | Cc1cc(F)ccc1-c1n(-c2c(C(C)C)cccc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C27H30FN2/c1-17(2)21-10-9-11-22(18(3)4)26(21)30-25-13-8-7-12-24(25)29(6)27(30)23-15-14-20(28)16-19(23)5/h7-18H,1-6H3/q+1 |
| InChIKey | PSMCKQBHTOMOKY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|