C39H39N2+ — CID 158086759
1-methyl-2-(2-methyl-5-phenylphenyl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium (PubChem CID 158086759) has the molecular formula C39H39N2+ and a molecular weight of 535.76 g/mol. Its IUPAC name is 1-methyl-2-(2-methyl-5-phenylphenyl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium.
| Compound Name | 1-methyl-2-(2-methyl-5-phenylphenyl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 158086759 |
| Molecular Formula | C39H39N2+ |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | 1-methyl-2-(2-methyl-5-phenylphenyl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
| SMILES | Cc1ccc(-c2ccccc2)cc1-c1n(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C39H39N2/c1-26(2)33-24-32(30-17-11-8-12-18-30)25-34(27(3)4)38(33)41-37-20-14-13-19-36(37)40(6)39(41)35-23-31(22-21-28(35)5)29-15-9-7-10-16-29/h7-27H,1-6H3/q+1 |
| InChIKey | PDZJDFKPEYXGBJ-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|