C46H43N2O+ — CID 168730818
2-(3,7-dimethyldibenzofuran-4-yl)-1-methyl-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium (PubChem CID 168730818) has the molecular formula C46H43N2O+ and a molecular weight of 639.86 g/mol. Its IUPAC name is 2-(3,7-dimethyldibenzofuran-4-yl)-1-methyl-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium.
| Compound Name | 2-(3,7-dimethyldibenzofuran-4-yl)-1-methyl-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 168730818 |
| Molecular Formula | C46H43N2O+ |
| Molecular Weight | 639.86 g/mol |
| Exact Mass | 639.34 |
| IUPAC Name | 2-(3,7-dimethyldibenzofuran-4-yl)-1-methyl-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
| SMILES | Cc1ccc2c(c1)oc1c(-c3n(-c4c(C(C)C)cc(-c5ccc(-c6ccccc6)cc5)cc4C(C)C)c4ccccc4[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C46H43N2O/c1-28(2)38-26-35(34-21-19-33(20-22-34)32-13-9-8-10-14-32)27-39(29(3)4)44(38)48-41-16-12-11-15-40(41)47(7)46(48)43-31(6)18-24-37-36-23-17-30(5)25-42(36)49-45(37)43/h8-29H,1-7H3/q+1 |
| InChIKey | HLHCWGZDQHHECD-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.86 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|