C43H45N2O+ — CID 167338989
2-(8-tert-butyl-3-methyldibenzofuran-4-yl)-1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium (PubChem CID 167338989) has the molecular formula C43H45N2O+ and a molecular weight of 605.85 g/mol. Its IUPAC name is 2-(8-tert-butyl-3-methyldibenzofuran-4-yl)-1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium.
| Compound Name | 2-(8-tert-butyl-3-methyldibenzofuran-4-yl)-1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 167338989 |
| Molecular Formula | C43H45N2O+ |
| Molecular Weight | 605.85 g/mol |
| Exact Mass | 605.35 |
| IUPAC Name | 2-(8-tert-butyl-3-methyldibenzofuran-4-yl)-1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
| SMILES | Cc1ccc2c(oc3ccc(C(C)(C)C)cc32)c1-c1n(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C43H45N2O/c1-26(2)33-23-30(29-15-11-10-12-16-29)24-34(27(3)4)40(33)45-37-18-14-13-17-36(37)44(9)42(45)39-28(5)19-21-32-35-25-31(43(6,7)8)20-22-38(35)46-41(32)39/h10-27H,1-9H3/q+1 |
| InChIKey | PWPWQSGIEMEPDD-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.85 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|