C46H40N3O+ — CID 176823826
7-methyl-8-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene (PubChem CID 176823826) has the molecular formula C46H40N3O+ and a molecular weight of 650.85 g/mol. Its IUPAC name is 7-methyl-8-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene.
| Compound Name | 7-methyl-8-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 176823826 |
| Molecular Formula | C46H40N3O+ |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | 7-methyl-8-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene |
| SMILES | Cc1ccc2c(oc3nc4c(ccc5ccccc54)cc32)c1-c1n(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C46H40N3O/c1-27(2)36-25-33(30-14-8-7-9-15-30)26-37(28(3)4)43(36)49-40-19-13-12-18-39(40)48(6)46(49)41-29(5)20-23-35-38-24-32-22-21-31-16-10-11-17-34(31)42(32)47-45(38)50-44(35)41/h7-28H,1-6H3/q+1 |
| InChIKey | ZUDXYDIZZBDNNN-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|