C46H43N2O+ — CID 172541917
1-methyl-2-(3-methyldibenzofuran-4-yl)-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]-5-(trideuteriomethyl)benzimidazol-1-ium (PubChem CID 172541917) has the molecular formula C46H43N2O+ and a molecular weight of 642.88 g/mol. Its IUPAC name is 1-methyl-2-(3-methyldibenzofuran-4-yl)-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]-5-(trideuteriomethyl)benzimidazol-1-ium.
| Compound Name | 1-methyl-2-(3-methyldibenzofuran-4-yl)-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]-5-(trideuteriomethyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 172541917 |
| Molecular Formula | C46H43N2O+ |
| Molecular Weight | 642.88 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | 1-methyl-2-(3-methyldibenzofuran-4-yl)-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]-5-(trideuteriomethyl)benzimidazol-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)n(-c1c(C(C)C)cc(-c3ccc(-c4ccccc4)cc3)cc1C(C)C)c(-c1c(C)ccc3c1oc1ccccc13)[n+]2C |
| InChI | InChI=1S/C46H43N2O/c1-28(2)38-26-35(34-21-19-33(20-22-34)32-13-9-8-10-14-32)27-39(29(3)4)44(38)48-41-25-30(5)17-24-40(41)47(7)46(48)43-31(6)18-23-37-36-15-11-12-16-42(36)49-45(37)43/h8-29H,1-7H3/q+1/i5D3 |
| InChIKey | JOZVLBODSLFETN-VPYROQPTSA-N |
| XLogP | 12.22 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.88 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|