C49H50N2OSi+ — CID 168731035
CID 168731035 (PubChem CID 168731035) has the molecular formula C49H50N2OSi+ and a molecular weight of 711.04 g/mol.
| Compound Name | CID 168731035 |
|---|---|
| PubChem CID | 168731035 |
| Molecular Formula | C49H50N2OSi+ |
| Molecular Weight | 711.04 g/mol |
| Exact Mass | 710.37 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(oc3ccccc32)c1-c1n(-c2c(C(C)C)cc(-c3ccc(-c4ccccc4)cc3)cc2C(C)C)c2ccc(CC[Si](C)C)cc2[n+]1C |
| InChI | InChI=1S/C49H50N2OSi/c1-31(2)41-29-38(37-22-20-36(21-23-37)35-14-10-9-11-15-35)30-42(32(3)4)47(41)51-43-25-19-34(26-27-53(7)8)28-44(43)50(6)49(51)46-33(5)18-24-40-39-16-12-13-17-45(39)52-48(40)46/h9-25,28-32H,26-27H2,1-8H3/q+1 |
| InChIKey | CCOFEXLVDNZKSK-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.04 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|