C45H37N2O3+ — CID 169322423
1-[5,7-di(propan-2-yl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaen-6-yl]-3-methyl-2-(3-methyldibenzofuran-4-yl)benzimidazol-3-ium (PubChem CID 169322423) has the molecular formula C45H37N2O3+ and a molecular weight of 653.80 g/mol. Its IUPAC name is 1-[5,7-di(propan-2-yl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaen-6-yl]-3-methyl-2-(3-methyldibenzofuran-4-yl)benzimidazol-3-ium.
| Compound Name | 1-[5,7-di(propan-2-yl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaen-6-yl]-3-methyl-2-(3-methyldibenzofuran-4-yl)benzimidazol-3-ium |
|---|---|
| PubChem CID | 169322423 |
| Molecular Formula | C45H37N2O3+ |
| Molecular Weight | 653.80 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | 1-[5,7-di(propan-2-yl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaen-6-yl]-3-methyl-2-(3-methyldibenzofuran-4-yl)benzimidazol-3-ium |
| SMILES | Cc1ccc2c(oc3ccccc32)c1-c1n(-c2c(C(C)C)cc3c(oc4c3ccc3c5ccccc5oc34)c2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C45H37N2O3/c1-24(2)32-23-33-31-22-21-30-28-14-8-12-18-37(28)49-43(30)44(31)50-42(33)38(25(3)4)40(32)47-35-16-10-9-15-34(35)46(6)45(47)39-26(5)19-20-29-27-13-7-11-17-36(27)48-41(29)39/h7-25H,1-6H3/q+1 |
| InChIKey | JGYHOJDZBUXUII-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 48.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.80 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|